C21H25N7O4S — CID 122315706
2-methoxy-5-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethylsulfamoyl]benzamide (PubChem CID 122315706) has the molecular formula C21H25N7O4S and a molecular weight of 471.54 g/mol. Its IUPAC name is 2-methoxy-5-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethylsulfamoyl]benzamide.
| Compound Name | 2-methoxy-5-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 122315706 |
| Molecular Formula | C21H25N7O4S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-methoxy-5-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethylsulfamoyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNc2cc(Nc3cc(C)ccn3)nc(C)n2)cc1C(N)=O |
| InChI | InChI=1S/C21H25N7O4S/c1-13-6-7-23-18(10-13)28-20-12-19(26-14(2)27-20)24-8-9-25-33(30,31)15-4-5-17(32-3)16(11-15)21(22)29/h4-7,10-12,25H,8-9H2,1-3H3,(H2,22,29)(H2,23,24,26,27,28) |
| InChIKey | XSRGYIBHPWYONK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 161.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|