C18H18F2N6O2S — CID 121064606
3,4-difluoro-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide (PubChem CID 121064606) has the molecular formula C18H18F2N6O2S and a molecular weight of 420.45 g/mol. Its IUPAC name is 3,4-difluoro-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121064606 |
| Molecular Formula | C18H18F2N6O2S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 3,4-difluoro-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
| SMILES | Cc1ccnc(Nc2ccc(NCCNS(=O)(=O)c3ccc(F)c(F)c3)nn2)c1 |
| InChI | InChI=1S/C18H18F2N6O2S/c1-12-6-7-21-18(10-12)24-17-5-4-16(25-26-17)22-8-9-23-29(27,28)13-2-3-14(19)15(20)11-13/h2-7,10-11,23H,8-9H2,1H3,(H,22,25)(H,21,24,26) |
| InChIKey | BWEHIWKHMOGMPA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|