C17H22N8O2S — CID 122288738
3,5-dimethyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-1H-pyrazole-4-sulfonamide (PubChem CID 122288738) has the molecular formula C17H22N8O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 122288738 |
| Molecular Formula | C17H22N8O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 3,5-dimethyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1ccnc(Nc2ccc(NCCNS(=O)(=O)c3c(C)n[nH]c3C)nn2)c1 |
| InChI | InChI=1S/C17H22N8O2S/c1-11-6-7-18-16(10-11)21-15-5-4-14(24-25-15)19-8-9-20-28(26,27)17-12(2)22-23-13(17)3/h4-7,10,20H,8-9H2,1-3H3,(H,19,24)(H,22,23)(H,18,21,25) |
| InChIKey | DMUNTIUALVVKAE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|