C16H20N8O2S — CID 122289503
3,5-dimethyl-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-1H-pyrazole-4-sulfonamide (PubChem CID 122289503) has the molecular formula C16H20N8O2S and a molecular weight of 388.46 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 122289503 |
| Molecular Formula | C16H20N8O2S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 3,5-dimethyl-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NCCNc1ccc(Nc2cccnc2)nn1 |
| InChI | InChI=1S/C16H20N8O2S/c1-11-16(12(2)22-21-11)27(25,26)19-9-8-18-14-5-6-15(24-23-14)20-13-4-3-7-17-10-13/h3-7,10,19H,8-9H2,1-2H3,(H,18,23)(H,20,24)(H,21,22) |
| InChIKey | BNYBZARRUNTAOK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|