C18H17N7O4S — CID 122289513
2-oxo-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-3H-1,3-benzoxazole-5-sulfonamide (PubChem CID 122289513) has the molecular formula C18H17N7O4S and a molecular weight of 427.45 g/mol. Its IUPAC name is 2-oxo-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-3H-1,3-benzoxazole-5-sulfonamide.
| Compound Name | 2-oxo-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-3H-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 122289513 |
| Molecular Formula | C18H17N7O4S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-oxo-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-3H-1,3-benzoxazole-5-sulfonamide |
| SMILES | O=c1[nH]c2cc(S(=O)(=O)NCCNc3ccc(Nc4cccnc4)nn3)ccc2o1 |
| InChI | InChI=1S/C18H17N7O4S/c26-18-23-14-10-13(3-4-15(14)29-18)30(27,28)21-9-8-20-16-5-6-17(25-24-16)22-12-2-1-7-19-11-12/h1-7,10-11,21H,8-9H2,(H,20,24)(H,22,25)(H,23,26) |
| InChIKey | ASRYQTHPEHWTAD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 154.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|