C13H21N7O2S — CID 122320936
N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 122320936) has the molecular formula C13H21N7O2S and a molecular weight of 339.43 g/mol. Its IUPAC name is N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 122320936 |
| Molecular Formula | C13H21N7O2S |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NCCNc1cc(N(C)C)cnn1 |
| InChI | InChI=1S/C13H21N7O2S/c1-9-13(10(2)18-17-9)23(21,22)16-6-5-14-12-7-11(20(3)4)8-15-19-12/h7-8,16H,5-6H2,1-4H3,(H,14,19)(H,17,18) |
| InChIKey | ZENQJILXVFCODM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|