C14H17F2N5O2S — CID 122320921
N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]-2,6-difluorobenzenesulfonamide (PubChem CID 122320921) has the molecular formula C14H17F2N5O2S and a molecular weight of 357.39 g/mol. Its IUPAC name is N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]-2,6-difluorobenzenesulfonamide.
| Compound Name | N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 122320921 |
| Molecular Formula | C14H17F2N5O2S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]-2,6-difluorobenzenesulfonamide |
| SMILES | CN(C)c1cnnc(NCCNS(=O)(=O)c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C14H17F2N5O2S/c1-21(2)10-8-13(20-18-9-10)17-6-7-19-24(22,23)14-11(15)4-3-5-12(14)16/h3-5,8-9,19H,6-7H2,1-2H3,(H,17,20) |
| InChIKey | UYOPQZQORQWKDC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|