C22H28N6O3S — CID 121064553
4-butoxy-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide (PubChem CID 121064553) has the molecular formula C22H28N6O3S and a molecular weight of 456.57 g/mol. Its IUPAC name is 4-butoxy-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-butoxy-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121064553 |
| Molecular Formula | C22H28N6O3S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 4-butoxy-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)NCCNc2ccc(Nc3cc(C)ccn3)nn2)cc1 |
| InChI | InChI=1S/C22H28N6O3S/c1-3-4-15-31-18-5-7-19(8-6-18)32(29,30)25-14-13-24-20-9-10-21(28-27-20)26-22-16-17(2)11-12-23-22/h5-12,16,25H,3-4,13-15H2,1-2H3,(H,24,27)(H,23,26,28) |
| InChIKey | AIQAKKNZZKZDIF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 118.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|