C19H20F2N6O2S — CID 122315666
2,5-difluoro-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzenesulfonamide (PubChem CID 122315666) has the molecular formula C19H20F2N6O2S and a molecular weight of 434.47 g/mol. Its IUPAC name is 2,5-difluoro-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122315666 |
| Molecular Formula | C19H20F2N6O2S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 2,5-difluoro-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
| SMILES | Cc1ccnc(Nc2cc(NCCNS(=O)(=O)c3cc(F)ccc3F)nc(C)n2)c1 |
| InChI | InChI=1S/C19H20F2N6O2S/c1-12-5-6-22-17(9-12)27-19-11-18(25-13(2)26-19)23-7-8-24-30(28,29)16-10-14(20)3-4-15(16)21/h3-6,9-11,24H,7-8H2,1-2H3,(H2,22,23,25,26,27) |
| InChIKey | FGQWVDOUNQERDQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|