C21H24ClN7O2 — CID 122315410
1-(5-chloro-2-methoxyphenyl)-3-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]urea (PubChem CID 122315410) has the molecular formula C21H24ClN7O2 and a molecular weight of 441.92 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 122315410 |
| Molecular Formula | C21H24ClN7O2 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)NCCNc1cc(Nc2cc(C)ccn2)nc(C)n1 |
| InChI | InChI=1S/C21H24ClN7O2/c1-13-6-7-23-18(10-13)29-20-12-19(26-14(2)27-20)24-8-9-25-21(30)28-16-11-15(22)4-5-17(16)31-3/h4-7,10-12H,8-9H2,1-3H3,(H2,25,28,30)(H2,23,24,26,27,29) |
| InChIKey | FQLKXASIGDENRY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|