C18H19N7O4S — CID 122314913
N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-3-nitrobenzenesulfonamide (PubChem CID 122314913) has the molecular formula C18H19N7O4S and a molecular weight of 429.46 g/mol. Its IUPAC name is N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122314913 |
| Molecular Formula | C18H19N7O4S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccnc(Nc2cc(NCCNS(=O)(=O)c3cccc([N+](=O)[O-])c3)ncn2)c1 |
| InChI | InChI=1S/C18H19N7O4S/c1-13-5-6-19-17(9-13)24-18-11-16(21-12-22-18)20-7-8-23-30(28,29)15-4-2-3-14(10-15)25(26)27/h2-6,9-12,23H,7-8H2,1H3,(H2,19,20,21,22,24) |
| InChIKey | IJCZZHIZNXJGDR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 152.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|