C17H19N7O4S — CID 121074784
N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-3-nitrobenzenesulfonamide (PubChem CID 121074784) has the molecular formula C17H19N7O4S and a molecular weight of 417.45 g/mol. Its IUPAC name is N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 121074784 |
| Molecular Formula | C17H19N7O4S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1nc(NCCNS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc(-n2ccnc2C)n1 |
| InChI | InChI=1S/C17H19N7O4S/c1-12-21-16(11-17(22-12)23-9-8-18-13(23)2)19-6-7-20-29(27,28)15-5-3-4-14(10-15)24(25)26/h3-5,8-11,20H,6-7H2,1-2H3,(H,19,21,22) |
| InChIKey | LYRLMADJBXSBRL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|