C15H24N6O2S — CID 121074772
N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]butane-1-sulfonamide (PubChem CID 121074772) has the molecular formula C15H24N6O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]butane-1-sulfonamide.
| Compound Name | N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 121074772 |
| Molecular Formula | C15H24N6O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCCNc1cc(-n2ccnc2C)nc(C)n1 |
| InChI | InChI=1S/C15H24N6O2S/c1-4-5-10-24(22,23)18-7-6-17-14-11-15(20-12(2)19-14)21-9-8-16-13(21)3/h8-9,11,18H,4-7,10H2,1-3H3,(H,17,19,20) |
| InChIKey | VEWADMHWVVTGGZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|