C20H24N6O3S — CID 121064893
4-methoxy-2,5-dimethyl-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide (PubChem CID 121064893) has the molecular formula C20H24N6O3S and a molecular weight of 428.52 g/mol. Its IUPAC name is 4-methoxy-2,5-dimethyl-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-methoxy-2,5-dimethyl-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121064893 |
| Molecular Formula | C20H24N6O3S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 4-methoxy-2,5-dimethyl-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)NCCNc2ccc(Nc3ccccn3)nn2)cc1C |
| InChI | InChI=1S/C20H24N6O3S/c1-14-13-17(15(2)12-16(14)29-3)30(27,28)23-11-10-22-19-7-8-20(26-25-19)24-18-6-4-5-9-21-18/h4-9,12-13,23H,10-11H2,1-3H3,(H,22,25)(H,21,24,26) |
| InChIKey | HNOLXLFKXMRQKP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 118.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|