C20H22F3N7O — CID 121072683
1-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 121072683) has the molecular formula C20H22F3N7O and a molecular weight of 433.44 g/mol. Its IUPAC name is 1-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 121072683 |
| Molecular Formula | C20H22F3N7O |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 1-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1cc(C)n(-c2cc(NCCNC(=O)Nc3cccc(C(F)(F)F)c3)nc(C)n2)n1 |
| InChI | InChI=1S/C20H22F3N7O/c1-12-9-13(2)30(29-12)18-11-17(26-14(3)27-18)24-7-8-25-19(31)28-16-6-4-5-15(10-16)20(21,22)23/h4-6,9-11H,7-8H2,1-3H3,(H,24,26,27)(H2,25,28,31) |
| InChIKey | MYVBHTLZEZPUQJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|