C21H25N7O3 — CID 121072696
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]urea (PubChem CID 121072696) has the molecular formula C21H25N7O3 and a molecular weight of 423.48 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]urea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 121072696 |
| Molecular Formula | C21H25N7O3 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]urea |
| SMILES | Cc1cc(C)n(-c2cc(NCCNC(=O)Nc3ccc4c(c3)OCCO4)nc(C)n2)n1 |
| InChI | InChI=1S/C21H25N7O3/c1-13-10-14(2)28(27-13)20-12-19(24-15(3)25-20)22-6-7-23-21(29)26-16-4-5-17-18(11-16)31-9-8-30-17/h4-5,10-12H,6-9H2,1-3H3,(H,22,24,25)(H2,23,26,29) |
| InChIKey | NLKSRJQAMYUMKP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|