C17H24N6O3 — CID 122320985
1-(2,3-dimethoxyphenyl)-3-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]urea (PubChem CID 122320985) has the molecular formula C17H24N6O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is 1-(2,3-dimethoxyphenyl)-3-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]urea.
| Compound Name | 1-(2,3-dimethoxyphenyl)-3-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 122320985 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 1-(2,3-dimethoxyphenyl)-3-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]urea |
| SMILES | COc1cccc(NC(=O)NCCNc2cc(N(C)C)cnn2)c1OC |
| InChI | InChI=1S/C17H24N6O3/c1-23(2)12-10-15(22-20-11-12)18-8-9-19-17(24)21-13-6-5-7-14(25-3)16(13)26-4/h5-7,10-11H,8-9H2,1-4H3,(H,18,22)(H2,19,21,24) |
| InChIKey | LZRWMMFBOFLAPS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|