C16H21N7O2S — CID 122308347
1-propan-2-yl-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]imidazole-4-sulfonamide (PubChem CID 122308347) has the molecular formula C16H21N7O2S and a molecular weight of 375.46 g/mol. Its IUPAC name is 1-propan-2-yl-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]imidazole-4-sulfonamide.
| Compound Name | 1-propan-2-yl-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 122308347 |
| Molecular Formula | C16H21N7O2S |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 1-propan-2-yl-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]imidazole-4-sulfonamide |
| SMILES | CC(C)n1cnc(S(=O)(=O)NCCNc2cc(-n3cccc3)ncn2)c1 |
| InChI | InChI=1S/C16H21N7O2S/c1-13(2)23-10-16(20-12-23)26(24,25)21-6-5-17-14-9-15(19-11-18-14)22-7-3-4-8-22/h3-4,7-13,21H,5-6H2,1-2H3,(H,17,18,19) |
| InChIKey | FFQOHEWBUSNLQW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|