C17H27N7O2S — CID 122327759
1-methyl-2-propan-2-yl-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]imidazole-4-sulfonamide (PubChem CID 122327759) has the molecular formula C17H27N7O2S and a molecular weight of 393.52 g/mol. Its IUPAC name is 1-methyl-2-propan-2-yl-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]imidazole-4-sulfonamide.
| Compound Name | 1-methyl-2-propan-2-yl-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 122327759 |
| Molecular Formula | C17H27N7O2S |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-methyl-2-propan-2-yl-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]imidazole-4-sulfonamide |
| SMILES | CC(C)c1nc(S(=O)(=O)NCCNc2cc(N3CCCC3)ncn2)cn1C |
| InChI | InChI=1S/C17H27N7O2S/c1-13(2)17-22-16(11-23(17)3)27(25,26)21-7-6-18-14-10-15(20-12-19-14)24-8-4-5-9-24/h10-13,21H,4-9H2,1-3H3,(H,18,19,20) |
| InChIKey | GOJVMIMIJHJECK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|