C17H27N7O2S — CID 122294548
1,2-dimethyl-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]imidazole-4-sulfonamide (PubChem CID 122294548) has the molecular formula C17H27N7O2S and a molecular weight of 393.52 g/mol. Its IUPAC name is 1,2-dimethyl-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]imidazole-4-sulfonamide.
| Compound Name | 1,2-dimethyl-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 122294548 |
| Molecular Formula | C17H27N7O2S |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1,2-dimethyl-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]imidazole-4-sulfonamide |
| SMILES | Cc1cc(N2CCCCC2)nc(NCCNS(=O)(=O)c2cn(C)c(C)n2)n1 |
| InChI | InChI=1S/C17H27N7O2S/c1-13-11-15(24-9-5-4-6-10-24)22-17(20-13)18-7-8-19-27(25,26)16-12-23(3)14(2)21-16/h11-12,19H,4-10H2,1-3H3,(H,18,20,22) |
| InChIKey | SDNCHWVACJCPPC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|