C13H24N6O2S — CID 121075493
2-[2-(dimethylsulfamoylamino)ethylamino]-4-methyl-6-pyrrolidin-1-ylpyrimidine (PubChem CID 121075493) has the molecular formula C13H24N6O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is 2-[2-(dimethylsulfamoylamino)ethylamino]-4-methyl-6-pyrrolidin-1-ylpyrimidine.
| Compound Name | 2-[2-(dimethylsulfamoylamino)ethylamino]-4-methyl-6-pyrrolidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 121075493 |
| Molecular Formula | C13H24N6O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2-[2-(dimethylsulfamoylamino)ethylamino]-4-methyl-6-pyrrolidin-1-ylpyrimidine |
| SMILES | Cc1cc(N2CCCC2)nc(NCCNS(=O)(=O)N(C)C)n1 |
| InChI | InChI=1S/C13H24N6O2S/c1-11-10-12(19-8-4-5-9-19)17-13(16-11)14-6-7-15-22(20,21)18(2)3/h10,15H,4-9H2,1-3H3,(H,14,16,17) |
| InChIKey | DROUWPDXIHGGGL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|