C19H26ClN5O3S — CID 122294543
5-chloro-2-methoxy-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]benzenesulfonamide (PubChem CID 122294543) has the molecular formula C19H26ClN5O3S and a molecular weight of 439.97 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 5-chloro-2-methoxy-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122294543 |
| Molecular Formula | C19H26ClN5O3S |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 5-chloro-2-methoxy-N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)NCCNc1nc(C)cc(N2CCCCC2)n1 |
| InChI | InChI=1S/C19H26ClN5O3S/c1-14-12-18(25-10-4-3-5-11-25)24-19(23-14)21-8-9-22-29(26,27)17-13-15(20)6-7-16(17)28-2/h6-7,12-13,22H,3-5,8-11H2,1-2H3,(H,21,23,24) |
| InChIKey | SEBALCLOOZQSJD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|