C14H22N4O4S — CID 86776771
N-(2-methoxyethyl)-4-(4-sulfamoylphenyl)piperazine-1-carboxamide (PubChem CID 86776771) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-(4-sulfamoylphenyl)piperazine-1-carboxamide.
| Compound Name | N-(2-methoxyethyl)-4-(4-sulfamoylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 86776771 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-(2-methoxyethyl)-4-(4-sulfamoylphenyl)piperazine-1-carboxamide |
| SMILES | COCCNC(=O)N1CCN(c2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C14H22N4O4S/c1-22-11-6-16-14(19)18-9-7-17(8-10-18)12-2-4-13(5-3-12)23(15,20)21/h2-5H,6-11H2,1H3,(H,16,19)(H2,15,20,21) |
| InChIKey | NRDANURCKIVIQS-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|