C22H29ClN4O3S — CID 55565672
2-[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 55565672) has the molecular formula C22H29ClN4O3S and a molecular weight of 465.02 g/mol. Its IUPAC name is 2-[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 55565672 |
| Molecular Formula | C22H29ClN4O3S |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CC(c1ccccc1Cl)N1CCN(CC(=O)NCCc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C22H29ClN4O3S/c1-17(20-4-2-3-5-21(20)23)27-14-12-26(13-15-27)16-22(28)25-11-10-18-6-8-19(9-7-18)31(24,29)30/h2-9,17H,10-16H2,1H3,(H,25,28)(H2,24,29,30) |
| InChIKey | XQNPMPFJJIHNDH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |