C16H23ClN4O2 — CID 134060036
2-[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-N-(methylcarbamoyl)acetamide (PubChem CID 134060036) has the molecular formula C16H23ClN4O2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 2-[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-N-(methylcarbamoyl)acetamide.
| Compound Name | 2-[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-N-(methylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 134060036 |
| Molecular Formula | C16H23ClN4O2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-N-(methylcarbamoyl)acetamide |
| SMILES | CNC(=O)NC(=O)CN1CCN(C(C)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C16H23ClN4O2/c1-12(13-5-3-4-6-14(13)17)21-9-7-20(8-10-21)11-15(22)19-16(23)18-2/h3-6,12H,7-11H2,1-2H3,(H2,18,19,22,23) |
| InChIKey | VXKSLQBVEQUJKJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |