C20H27N3O2 — CID 112974290
1-methyl-1-(2-pyridin-4-ylethyl)-3-[2-(2,3,6-trimethylphenoxy)ethyl]urea (PubChem CID 112974290) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 1-methyl-1-(2-pyridin-4-ylethyl)-3-[2-(2,3,6-trimethylphenoxy)ethyl]urea.
| Compound Name | 1-methyl-1-(2-pyridin-4-ylethyl)-3-[2-(2,3,6-trimethylphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 112974290 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-methyl-1-(2-pyridin-4-ylethyl)-3-[2-(2,3,6-trimethylphenoxy)ethyl]urea |
| SMILES | Cc1ccc(C)c(OCCNC(=O)N(C)CCc2ccncc2)c1C |
| InChI | InChI=1S/C20H27N3O2/c1-15-5-6-16(2)19(17(15)3)25-14-12-22-20(24)23(4)13-9-18-7-10-21-11-8-18/h5-8,10-11H,9,12-14H2,1-4H3,(H,22,24) |
| InChIKey | UGRJWGYZVVKLFE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|