C21H17N5O2 — CID 123657138
N-[4-[[(2-oxo-1H-pyrido[2,3-d]pyrimidin-4-yl)amino]methyl]phenyl]benzamide (PubChem CID 123657138) has the molecular formula C21H17N5O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is N-[4-[[(2-oxo-1H-pyrido[2,3-d]pyrimidin-4-yl)amino]methyl]phenyl]benzamide.
| Compound Name | N-[4-[[(2-oxo-1H-pyrido[2,3-d]pyrimidin-4-yl)amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 123657138 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-[4-[[(2-oxo-1H-pyrido[2,3-d]pyrimidin-4-yl)amino]methyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(CNc2nc(=O)[nH]c3ncccc23)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H17N5O2/c27-20(15-5-2-1-3-6-15)24-16-10-8-14(9-11-16)13-23-19-17-7-4-12-22-18(17)25-21(28)26-19/h1-12H,13H2,(H,24,27)(H2,22,23,25,26,28) |
| InChIKey | DILSMFMJIRYTDK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |