C27H21N5O3 — CID 67253188
4-[3-[[(1-hydroxy-2-oxopyrido[2,3-d]pyrimidin-4-yl)amino]methyl]phenyl]-N-phenylbenzamide (PubChem CID 67253188) has the molecular formula C27H21N5O3 and a molecular weight of 463.50 g/mol. Its IUPAC name is 4-[3-[[(1-hydroxy-2-oxopyrido[2,3-d]pyrimidin-4-yl)amino]methyl]phenyl]-N-phenylbenzamide.
| Compound Name | 4-[3-[[(1-hydroxy-2-oxopyrido[2,3-d]pyrimidin-4-yl)amino]methyl]phenyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 67253188 |
| Molecular Formula | C27H21N5O3 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 4-[3-[[(1-hydroxy-2-oxopyrido[2,3-d]pyrimidin-4-yl)amino]methyl]phenyl]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(-c2cccc(CNc3nc(=O)n(O)c4ncccc34)c2)cc1 |
| InChI | InChI=1S/C27H21N5O3/c33-26(30-22-8-2-1-3-9-22)20-13-11-19(12-14-20)21-7-4-6-18(16-21)17-29-24-23-10-5-15-28-25(23)32(35)27(34)31-24/h1-16,35H,17H2,(H,30,33)(H,29,31,34) |
| InChIKey | DDOQPNBBNGSWBF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|