C23H21N5O2 — CID 123289202
4-[3-[(2-oxo-1H-pyrido[2,3-d]pyrimidin-4-yl)amino]propyl]-N-phenylbenzamide (PubChem CID 123289202) has the molecular formula C23H21N5O2 and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-[3-[(2-oxo-1H-pyrido[2,3-d]pyrimidin-4-yl)amino]propyl]-N-phenylbenzamide.
| Compound Name | 4-[3-[(2-oxo-1H-pyrido[2,3-d]pyrimidin-4-yl)amino]propyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 123289202 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-[3-[(2-oxo-1H-pyrido[2,3-d]pyrimidin-4-yl)amino]propyl]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(CCCNc2nc(=O)[nH]c3ncccc23)cc1 |
| InChI | InChI=1S/C23H21N5O2/c29-22(26-18-7-2-1-3-8-18)17-12-10-16(11-13-17)6-4-14-24-20-19-9-5-15-25-21(19)28-23(30)27-20/h1-3,5,7-13,15H,4,6,14H2,(H,26,29)(H2,24,25,27,28,30) |
| InChIKey | DEGDZIWNTYCFEJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|