C17H20O3 — CID 126487548
2-(5-hydroxynaphthalen-1-yl)ethyl 2,2-dimethylpropanoate (PubChem CID 126487548) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 2-(5-hydroxynaphthalen-1-yl)ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-(5-hydroxynaphthalen-1-yl)ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 126487548 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 2-(5-hydroxynaphthalen-1-yl)ethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C17H20O3/c1-17(2,3)16(19)20-11-10-12-6-4-8-14-13(12)7-5-9-15(14)18/h4-9,18H,10-11H2,1-3H3 |
| InChIKey | FFBYSUFVPHNJSQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |