C14H20O5 — CID 175389257
[3,3-dihydroxy-3-(2-hydroxyphenyl)propyl] 2,2-dimethylpropanoate (PubChem CID 175389257) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is [3,3-dihydroxy-3-(2-hydroxyphenyl)propyl] 2,2-dimethylpropanoate.
| Compound Name | [3,3-dihydroxy-3-(2-hydroxyphenyl)propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 175389257 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | [3,3-dihydroxy-3-(2-hydroxyphenyl)propyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCC(O)(O)c1ccccc1O |
| InChI | InChI=1S/C14H20O5/c1-13(2,3)12(16)19-9-8-14(17,18)10-6-4-5-7-11(10)15/h4-7,15,17-18H,8-9H2,1-3H3 |
| InChIKey | IFLKKPLJFSKPHD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|