C17H19IO3 — CID 134565439
2-(5-hydroxynaphthalen-1-yl)ethyl 2-iodo-2-methylbutanoate (PubChem CID 134565439) has the molecular formula C17H19IO3 and a molecular weight of 398.24 g/mol. Its IUPAC name is 2-(5-hydroxynaphthalen-1-yl)ethyl 2-iodo-2-methylbutanoate.
| Compound Name | 2-(5-hydroxynaphthalen-1-yl)ethyl 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 134565439 |
| Molecular Formula | C17H19IO3 |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 2-(5-hydroxynaphthalen-1-yl)ethyl 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OCCc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C17H19IO3/c1-3-17(2,18)16(20)21-11-10-12-6-4-8-14-13(12)7-5-9-15(14)19/h4-9,19H,3,10-11H2,1-2H3 |
| InChIKey | MMBXLPGIPLNKKL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|