C14H13IO6 — CID 134565417
2-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-trien-2-yl)oxy]ethyl 2-iodo-2-methylbutanoate (PubChem CID 134565417) has the molecular formula C14H13IO6 and a molecular weight of 404.16 g/mol. Its IUPAC name is 2-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-trien-2-yl)oxy]ethyl 2-iodo-2-methylbutanoate.
| Compound Name | 2-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-trien-2-yl)oxy]ethyl 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 134565417 |
| Molecular Formula | C14H13IO6 |
| Molecular Weight | 404.16 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | 2-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-trien-2-yl)oxy]ethyl 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OCCOc1c2c3oc1cc3C(=O)O2 |
| InChI | InChI=1S/C14H13IO6/c1-3-14(2,15)13(17)19-5-4-18-10-8-6-7-9(20-8)11(10)21-12(7)16/h6H,3-5H2,1-2H3 |
| InChIKey | ASIYVOGKWLTRQJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.16 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|