C11H9IO6S — CID 129168606
(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nona-1(9),2,6-trien-2-yl) 2-iodo-2-methylbutanoate (PubChem CID 129168606) has the molecular formula C11H9IO6S and a molecular weight of 396.16 g/mol. Its IUPAC name is (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nona-1(9),2,6-trien-2-yl) 2-iodo-2-methylbutanoate.
| Compound Name | (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nona-1(9),2,6-trien-2-yl) 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 129168606 |
| Molecular Formula | C11H9IO6S |
| Molecular Weight | 396.16 g/mol |
| Exact Mass | 395.92 |
| IUPAC Name | (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nona-1(9),2,6-trien-2-yl) 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)Oc1c2c3oc1cc3S(=O)(=O)O2 |
| InChI | InChI=1S/C11H9IO6S/c1-3-11(2,12)10(13)17-7-5-4-6-8(16-5)9(7)18-19(6,14)15/h4H,3H2,1-2H3 |
| InChIKey | OSGSQDDXSVVVEX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|