C11H8O5 — CID 134224510
(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-trien-2-yl) butanoate (PubChem CID 134224510) has the molecular formula C11H8O5 and a molecular weight of 220.18 g/mol. Its IUPAC name is (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-trien-2-yl) butanoate.
| Compound Name | (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-trien-2-yl) butanoate |
|---|---|
| PubChem CID | 134224510 |
| Molecular Formula | C11H8O5 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-trien-2-yl) butanoate |
| SMILES | CCCC(=O)Oc1c2c3oc1cc3C(=O)O2 |
| InChI | InChI=1S/C11H8O5/c1-2-3-7(12)15-9-6-4-5-8(14-6)10(9)16-11(5)13/h4H,2-3H2,1H3 |
| InChIKey | KLEXJJPCYOWWDR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|