C12H6O7 — CID 166810472
[2-oxo-2-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-trien-2-yl)oxy]ethyl] prop-2-enoate (PubChem CID 166810472) has the molecular formula C12H6O7 and a molecular weight of 262.17 g/mol. Its IUPAC name is [2-oxo-2-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-trien-2-yl)oxy]ethyl] prop-2-enoate.
| Compound Name | [2-oxo-2-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-trien-2-yl)oxy]ethyl] prop-2-enoate |
|---|---|
| PubChem CID | 166810472 |
| Molecular Formula | C12H6O7 |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | [2-oxo-2-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-trien-2-yl)oxy]ethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(=O)Oc1c2c3oc1cc3C(=O)O2 |
| InChI | InChI=1S/C12H6O7/c1-2-7(13)16-4-8(14)18-10-6-3-5-9(17-6)11(10)19-12(5)15/h2-3H,1,4H2 |
| InChIKey | ZTRYBNUQZTXRRE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|