C10H4O5 — CID 126487497
(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-trien-2-yl) prop-2-enoate (PubChem CID 126487497) has the molecular formula C10H4O5 and a molecular weight of 204.14 g/mol. Its IUPAC name is (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-trien-2-yl) prop-2-enoate.
| Compound Name | (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-trien-2-yl) prop-2-enoate |
|---|---|
| PubChem CID | 126487497 |
| Molecular Formula | C10H4O5 |
| Molecular Weight | 204.14 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | (5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-trien-2-yl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1c2c3oc1cc3C(=O)O2 |
| InChI | InChI=1S/C10H4O5/c1-2-6(11)14-8-5-3-4-7(13-5)9(8)15-10(4)12/h2-3H,1H2 |
| InChIKey | UDNCHVHWGMCTQL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.14 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|