C16H9Cl3O4 — CID 163406382
(2,3,6-trichloro-4-prop-2-enoyloxynaphthalen-1-yl) prop-2-enoate (PubChem CID 163406382) has the molecular formula C16H9Cl3O4 and a molecular weight of 371.60 g/mol. Its IUPAC name is (2,3,6-trichloro-4-prop-2-enoyloxynaphthalen-1-yl) prop-2-enoate.
| Compound Name | (2,3,6-trichloro-4-prop-2-enoyloxynaphthalen-1-yl) prop-2-enoate |
|---|---|
| PubChem CID | 163406382 |
| Molecular Formula | C16H9Cl3O4 |
| Molecular Weight | 371.60 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | (2,3,6-trichloro-4-prop-2-enoyloxynaphthalen-1-yl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(Cl)c(Cl)c(OC(=O)C=C)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C16H9Cl3O4/c1-3-11(20)22-15-9-6-5-8(17)7-10(9)16(14(19)13(15)18)23-12(21)4-2/h3-7H,1-2H2 |
| InChIKey | QUOLUOMSOAOOSG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|