About 2-(2-hydroxyphenyl)ethyl methyl carbonate
2-(2-hydroxyphenyl)ethyl methyl carbonate (PubChem CID 102381478) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)ethyl methyl carbonate.
Molecular Properties
| Compound Name | 2-(2-hydroxyphenyl)ethyl methyl carbonate |
| PubChem CID | 102381478 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-(2-hydroxyphenyl)ethyl methyl carbonate |
| SMILES | COC(=O)OCCc1ccccc1O |
| InChI | InChI=1S/C10H12O4/c1-13-10(12)14-7-6-8-4-2-3-5-9(8)11/h2-5,11H,6-7H2,1H3 |
| InChIKey | MLAYJMPULUOUKT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-hydroxyphenyl)ethyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyphenyl)ethyl methyl carbonate?
The IUPAC name of 2-(2-hydroxyphenyl)ethyl methyl carbonate (CID 102381478) is 2-(2-hydroxyphenyl)ethyl methyl carbonate.
What is the SMILES notation for 2-(2-hydroxyphenyl)ethyl methyl carbonate?
The canonical SMILES for 2-(2-hydroxyphenyl)ethyl methyl carbonate is COC(=O)OCCc1ccccc1O.
What is the InChIKey of 2-(2-hydroxyphenyl)ethyl methyl carbonate?
The InChIKey is MLAYJMPULUOUKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-13-10(12)14-7-6-8-4-2-3-5-9(8)11/h2-5,11H,6-7H2,1H3.
What are the key properties of 2-(2-hydroxyphenyl)ethyl methyl carbonate?
2-(2-hydroxyphenyl)ethyl methyl carbonate has a molecular weight of 196.20 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyphenyl)ethyl methyl carbonate is sourced from PubChem (CID 102381478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).