C15H22O — CID 145021602
2-pentoxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 145021602) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-pentoxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-pentoxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 145021602 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 2-pentoxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCCOC1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H22O/c1-2-3-6-11-16-15-10-9-13-7-4-5-8-14(13)12-15/h4-5,7-8,15H,2-3,6,9-12H2,1H3 |
| InChIKey | KZOWJMJLMVRYOG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|