C14H13N3O4 — CID 59976143
[(1R,2R)-1-(4-nitroimidazol-1-yl)-2,3-dihydro-1H-inden-2-yl] acetate (PubChem CID 59976143) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is [(1R,2R)-1-(4-nitroimidazol-1-yl)-2,3-dihydro-1H-inden-2-yl] acetate.
| Compound Name | [(1R,2R)-1-(4-nitroimidazol-1-yl)-2,3-dihydro-1H-inden-2-yl] acetate |
|---|---|
| PubChem CID | 59976143 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | [(1R,2R)-1-(4-nitroimidazol-1-yl)-2,3-dihydro-1H-inden-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1Cc2ccccc2[C@H]1n1cnc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13N3O4/c1-9(18)21-12-6-10-4-2-3-5-11(10)14(12)16-7-13(15-8-16)17(19)20/h2-5,7-8,12,14H,6H2,1H3/t12-,14-/m1/s1 |
| InChIKey | SJJIILJKOKWWRW-TZMCWYRMSA-N |
| XLogP | 1.87 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|