C26H23NO4 — CID 71480367
[(1R,2S)-1-(1,3-dioxobenzo[de]isoquinolin-2-yl)-2,3-dihydro-1H-inden-2-yl] (2S)-2-methylbutanoate (PubChem CID 71480367) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is [(1R,2S)-1-(1,3-dioxobenzo[de]isoquinolin-2-yl)-2,3-dihydro-1H-inden-2-yl] (2S)-2-methylbutanoate.
| Compound Name | [(1R,2S)-1-(1,3-dioxobenzo[de]isoquinolin-2-yl)-2,3-dihydro-1H-inden-2-yl] (2S)-2-methylbutanoate |
|---|---|
| PubChem CID | 71480367 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [(1R,2S)-1-(1,3-dioxobenzo[de]isoquinolin-2-yl)-2,3-dihydro-1H-inden-2-yl] (2S)-2-methylbutanoate |
| SMILES | CC[C@H](C)C(=O)O[C@H]1Cc2ccccc2[C@H]1N1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C26H23NO4/c1-3-15(2)26(30)31-21-14-17-8-4-5-11-18(17)23(21)27-24(28)19-12-6-9-16-10-7-13-20(22(16)19)25(27)29/h4-13,15,21,23H,3,14H2,1-2H3/t15-,21-,23+/m0/s1 |
| InChIKey | MCZSZWXUQVTUPC-VSUDMRMVSA-N |
| XLogP | 4.69 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|