C13H14NO5P — CID 140809775
(1,3-dioxoisoindol-2-yl)oxyphosphanyl 2-methylbutanoate (PubChem CID 140809775) has the molecular formula C13H14NO5P and a molecular weight of 295.23 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)oxyphosphanyl 2-methylbutanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)oxyphosphanyl 2-methylbutanoate |
|---|---|
| PubChem CID | 140809775 |
| Molecular Formula | C13H14NO5P |
| Molecular Weight | 295.23 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)oxyphosphanyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OPON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H14NO5P/c1-3-8(2)13(17)18-20-19-14-11(15)9-6-4-5-7-10(9)12(14)16/h4-8,20H,3H2,1-2H3 |
| InChIKey | PSUQWNCMPZBLGD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|