C26H20N2O5 — CID 52937168
2-[(1R,4R)-4-(1,3-dioxoisoindol-2-yl)-3-oxo-1-phenyl-4,5-dihydro-1H-2-benzazepin-2-yl]acetic acid (PubChem CID 52937168) has the molecular formula C26H20N2O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is 2-[(1R,4R)-4-(1,3-dioxoisoindol-2-yl)-3-oxo-1-phenyl-4,5-dihydro-1H-2-benzazepin-2-yl]acetic acid.
| Compound Name | 2-[(1R,4R)-4-(1,3-dioxoisoindol-2-yl)-3-oxo-1-phenyl-4,5-dihydro-1H-2-benzazepin-2-yl]acetic acid |
|---|---|
| PubChem CID | 52937168 |
| Molecular Formula | C26H20N2O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-[(1R,4R)-4-(1,3-dioxoisoindol-2-yl)-3-oxo-1-phenyl-4,5-dihydro-1H-2-benzazepin-2-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)[C@H](N2C(=O)c3ccccc3C2=O)Cc2ccccc2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H20N2O5/c29-22(30)15-27-23(16-8-2-1-3-9-16)18-11-5-4-10-17(18)14-21(26(27)33)28-24(31)19-12-6-7-13-20(19)25(28)32/h1-13,21,23H,14-15H2,(H,29,30)/t21-,23-/m1/s1 |
| InChIKey | CFDZUSISTSEBHW-FYYLOGMGSA-N |
| XLogP | 2.91 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|