C20H16N2O5S — CID 70059603
2-[(2S)-5-(1,3-dioxoisoindol-2-yl)-4-oxo-2-phenyl-1,3-thiazinan-3-yl]acetic acid (PubChem CID 70059603) has the molecular formula C20H16N2O5S and a molecular weight of 396.42 g/mol. Its IUPAC name is 2-[(2S)-5-(1,3-dioxoisoindol-2-yl)-4-oxo-2-phenyl-1,3-thiazinan-3-yl]acetic acid.
| Compound Name | 2-[(2S)-5-(1,3-dioxoisoindol-2-yl)-4-oxo-2-phenyl-1,3-thiazinan-3-yl]acetic acid |
|---|---|
| PubChem CID | 70059603 |
| Molecular Formula | C20H16N2O5S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-[(2S)-5-(1,3-dioxoisoindol-2-yl)-4-oxo-2-phenyl-1,3-thiazinan-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(N2C(=O)c3ccccc3C2=O)CS[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H16N2O5S/c23-16(24)10-21-19(27)15(11-28-20(21)12-6-2-1-3-7-12)22-17(25)13-8-4-5-9-14(13)18(22)26/h1-9,15,20H,10-11H2,(H,23,24)/t15?,20-/m0/s1 |
| InChIKey | JRGZTWMPFYNILH-MBABXSBOSA-N |
| XLogP | 2.01 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|