C15H15F3O — CID 134980832
[(1S,6S)-3-methyl-6-(trifluoromethyl)cyclohex-3-en-1-yl]-phenylmethanone (PubChem CID 134980832) has the molecular formula C15H15F3O and a molecular weight of 268.28 g/mol. Its IUPAC name is [(1S,6S)-3-methyl-6-(trifluoromethyl)cyclohex-3-en-1-yl]-phenylmethanone.
| Compound Name | [(1S,6S)-3-methyl-6-(trifluoromethyl)cyclohex-3-en-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 134980832 |
| Molecular Formula | C15H15F3O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | [(1S,6S)-3-methyl-6-(trifluoromethyl)cyclohex-3-en-1-yl]-phenylmethanone |
| SMILES | CC1=CC[C@H](C(F)(F)F)[C@@H](C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C15H15F3O/c1-10-7-8-13(15(16,17)18)12(9-10)14(19)11-5-3-2-4-6-11/h2-7,12-13H,8-9H2,1H3/t12-,13-/m0/s1 |
| InChIKey | RVYGDSZCOMCJDG-STQMWFEESA-N |
| XLogP | 4.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|