C23H21F3N2O4 — CID 1311027
(1R,6R)-4-methyl-6-[[2-[[4-(trifluoromethyl)benzoyl]amino]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 1311027) has the molecular formula C23H21F3N2O4 and a molecular weight of 446.43 g/mol. Its IUPAC name is (1R,6R)-4-methyl-6-[[2-[[4-(trifluoromethyl)benzoyl]amino]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6R)-4-methyl-6-[[2-[[4-(trifluoromethyl)benzoyl]amino]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 1311027 |
| Molecular Formula | C23H21F3N2O4 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | (1R,6R)-4-methyl-6-[[2-[[4-(trifluoromethyl)benzoyl]amino]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=CC[C@@H](C(=O)O)[C@H](C(=O)Nc2ccccc2NC(=O)c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C23H21F3N2O4/c1-13-6-11-16(22(31)32)17(12-13)21(30)28-19-5-3-2-4-18(19)27-20(29)14-7-9-15(10-8-14)23(24,25)26/h2-10,16-17H,11-12H2,1H3,(H,27,29)(H,28,30)(H,31,32)/t16-,17-/m1/s1 |
| InChIKey | IHPUGLFJETVAQS-IAGOWNOFSA-N |
| XLogP | 4.95 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|