C20H20N2O5 — CID 45034139
6-[[(3-hydroxynaphthalene-2-carbonyl)amino]carbamoyl]-4-methylcyclohex-3-ene-1-carboxylic acid (PubChem CID 45034139) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 6-[[(3-hydroxynaphthalene-2-carbonyl)amino]carbamoyl]-4-methylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[(3-hydroxynaphthalene-2-carbonyl)amino]carbamoyl]-4-methylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 45034139 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 6-[[(3-hydroxynaphthalene-2-carbonyl)amino]carbamoyl]-4-methylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=CCC(C(=O)O)C(C(=O)NNC(=O)c2cc3ccccc3cc2O)C1 |
| InChI | InChI=1S/C20H20N2O5/c1-11-6-7-14(20(26)27)15(8-11)18(24)21-22-19(25)16-9-12-4-2-3-5-13(12)10-17(16)23/h2-6,9-10,14-15,23H,7-8H2,1H3,(H,21,24)(H,22,25)(H,26,27) |
| InChIKey | XIKQEWGMNSQLTP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|