C18H20N2O2 — CID 3613240
3-hydroxy-N'-(4-methylcyclohexen-1-yl)naphthalene-2-carbohydrazide (PubChem CID 3613240) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-hydroxy-N'-(4-methylcyclohexen-1-yl)naphthalene-2-carbohydrazide.
| Compound Name | 3-hydroxy-N'-(4-methylcyclohexen-1-yl)naphthalene-2-carbohydrazide |
|---|---|
| PubChem CID | 3613240 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 3-hydroxy-N'-(4-methylcyclohexen-1-yl)naphthalene-2-carbohydrazide |
| SMILES | CC1CC=C(NNC(=O)c2cc3ccccc3cc2O)CC1 |
| InChI | InChI=1S/C18H20N2O2/c1-12-6-8-15(9-7-12)19-20-18(22)16-10-13-4-2-3-5-14(13)11-17(16)21/h2-5,8,10-12,19,21H,6-7,9H2,1H3,(H,20,22) |
| InChIKey | MWXKEAFERGZXPV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|