C19H20N2O3 — CID 3285978
N'-(3,3-dimethyl-5-oxocyclohexen-1-yl)-3-hydroxynaphthalene-2-carbohydrazide (PubChem CID 3285978) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is N'-(3,3-dimethyl-5-oxocyclohexen-1-yl)-3-hydroxynaphthalene-2-carbohydrazide.
| Compound Name | N'-(3,3-dimethyl-5-oxocyclohexen-1-yl)-3-hydroxynaphthalene-2-carbohydrazide |
|---|---|
| PubChem CID | 3285978 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N'-(3,3-dimethyl-5-oxocyclohexen-1-yl)-3-hydroxynaphthalene-2-carbohydrazide |
| SMILES | CC1(C)C=C(NNC(=O)c2cc3ccccc3cc2O)CC(=O)C1 |
| InChI | InChI=1S/C19H20N2O3/c1-19(2)10-14(9-15(22)11-19)20-21-18(24)16-7-12-5-3-4-6-13(12)8-17(16)23/h3-8,10,20,23H,9,11H2,1-2H3,(H,21,24) |
| InChIKey | XFCSKYAQHQSWCK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|